About N-methylindazol-1-amine
N-methylindazol-1-amine (PubChem CID 15129846) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is N-methylindazol-1-amine.
Molecular Properties
| Compound Name | N-methylindazol-1-amine |
| PubChem CID | 15129846 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | N-methylindazol-1-amine |
| SMILES | CNn1ncc2ccccc21 |
| InChI | InChI=1S/C8H9N3/c1-9-11-8-5-3-2-4-7(8)6-10-11/h2-6,9H,1H3 |
| InChIKey | DZRIDWVBXLSTHZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylindazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylindazol-1-amine?
The IUPAC name of N-methylindazol-1-amine (CID 15129846) is N-methylindazol-1-amine.
What is the SMILES notation for N-methylindazol-1-amine?
The canonical SMILES for N-methylindazol-1-amine is CNn1ncc2ccccc21.
What is the InChIKey of N-methylindazol-1-amine?
The InChIKey is DZRIDWVBXLSTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-9-11-8-5-3-2-4-7(8)6-10-11/h2-6,9H,1H3.
What are the key properties of N-methylindazol-1-amine?
N-methylindazol-1-amine has a molecular weight of 147.18 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylindazol-1-amine is sourced from PubChem (CID 15129846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).