About (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid
(4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 151301530) has the molecular formula C16H26N2O6
and a molecular weight of 342.39 g/mol. Its IUPAC name is (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid |
| PubChem CID | 151301530 |
| Molecular Formula | C16H26N2O6 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC=CCC1(C(=O)O)C[C@@H](N(C)C(=O)OC(C)(C)C)CN1C(=O)O |
| InChI | InChI=1S/C16H26N2O6/c1-6-7-8-16(12(19)20)9-11(10-18(16)13(21)22)17(5)14(23)24-15(2,3)4/h6-7,11H,8-10H2,1-5H3,(H,19,20)(H,21,22)/t11-,16?/m1/s1 |
| InChIKey | OCNGVIOWSWJHOY-ZVDHGWRTSA-N |
| XLogP | 2.40 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid (CID 151301530) is (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid is CC=CCC1(C(=O)O)C[C@@H](N(C)C(=O)OC(C)(C)C)CN1C(=O)O.
What is the InChIKey of (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid?
The InChIKey is OCNGVIOWSWJHOY-ZVDHGWRTSA-N. The full InChI is InChI=1S/C16H26N2O6/c1-6-7-8-16(12(19)20)9-11(10-18(16)13(21)22)17(5)14(23)24-15(2,3)4/h6-7,11H,8-10H2,1-5H3,(H,19,20)(H,21,22)/t11-,16?/m1/s1.
What are the key properties of (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid?
(4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid has a molecular weight of 342.39 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-but-2-enyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 151301530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).