C30H56F2O4 — CID 151303104
7-[(1R,2R)-2-(4,4-difluoro-3-pentoxyoctyl)-5-pentoxycyclopentyl]heptanoic acid (PubChem CID 151303104) has the molecular formula C30H56F2O4 and a molecular weight of 518.77 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4,4-difluoro-3-pentoxyoctyl)-5-pentoxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R)-2-(4,4-difluoro-3-pentoxyoctyl)-5-pentoxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 151303104 |
| Molecular Formula | C30H56F2O4 |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.41 |
| IUPAC Name | 7-[(1R,2R)-2-(4,4-difluoro-3-pentoxyoctyl)-5-pentoxycyclopentyl]heptanoic acid |
| SMILES | CCCCCOC1CC[C@H](CCC(OCCCCC)C(F)(F)CCCC)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C30H56F2O4/c1-4-7-14-23-35-27-20-18-25(26(27)16-12-10-11-13-17-29(33)34)19-21-28(36-24-15-8-5-2)30(31,32)22-9-6-3/h25-28H,4-24H2,1-3H3,(H,33,34)/t25-,26-,27?,28?/m1/s1 |
| InChIKey | OCVIAYANPQZBLI-XPALAHHGSA-N |
| XLogP | 9.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|