C10H8F12O — CID 15130345
2,5-bis(1,1,2,3,3,3-hexafluoropropyl)oxolane (PubChem CID 15130345) has the molecular formula C10H8F12O and a molecular weight of 372.15 g/mol. Its IUPAC name is 2,5-bis(1,1,2,3,3,3-hexafluoropropyl)oxolane.
| Compound Name | 2,5-bis(1,1,2,3,3,3-hexafluoropropyl)oxolane |
|---|---|
| PubChem CID | 15130345 |
| Molecular Formula | C10H8F12O |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2,5-bis(1,1,2,3,3,3-hexafluoropropyl)oxolane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C10H8F12O/c11-5(9(17,18)19)7(13,14)3-1-2-4(23-3)8(15,16)6(12)10(20,21)22/h3-6H,1-2H2 |
| InChIKey | FEKIUILHFNMJIQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |