C16H14F3N7 — CID 151305414
2-quinoxalin-6-yl-4-(2,2,2-trifluoroethylimino)-3,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 151305414) has the molecular formula C16H14F3N7 and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-quinoxalin-6-yl-4-(2,2,2-trifluoroethylimino)-3,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 2-quinoxalin-6-yl-4-(2,2,2-trifluoroethylimino)-3,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 151305414 |
| Molecular Formula | C16H14F3N7 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-quinoxalin-6-yl-4-(2,2,2-trifluoroethylimino)-3,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | NC1(c2ccc3nccnc3c2)N/C(=N/CC(F)(F)F)c2cc[nH]c2N1 |
| InChI | InChI=1S/C16H14F3N7/c17-15(18,19)8-24-14-10-3-4-23-13(10)25-16(20,26-14)9-1-2-11-12(7-9)22-6-5-21-11/h1-7,23,25H,8,20H2,(H,24,26) |
| InChIKey | LFBKRUXYSZPFHX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|