About 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide
3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide (PubChem CID 151306423) has the molecular formula C14H11Cl2N5O
and a molecular weight of 336.18 g/mol. Its IUPAC name is 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide.
Molecular Properties
| Compound Name | 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide |
| PubChem CID | 151306423 |
| Molecular Formula | C14H11Cl2N5O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide |
| SMILES | N#CCCc1cccc(C(N)=O)c1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C14H11Cl2N5O/c15-10-7-19-14(16)21-13(10)20-11-8(4-2-6-17)3-1-5-9(11)12(18)22/h1,3,5,7H,2,4H2,(H2,18,22)(H,19,20,21) |
| InChIKey | ODMXFSWWRYECIY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide?
The IUPAC name of 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide (CID 151306423) is 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide.
What is the SMILES notation for 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide?
The canonical SMILES for 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide is N#CCCc1cccc(C(N)=O)c1Nc1nc(Cl)ncc1Cl.
What is the InChIKey of 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide?
The InChIKey is ODMXFSWWRYECIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2N5O/c15-10-7-19-14(16)21-13(10)20-11-8(4-2-6-17)3-1-5-9(11)12(18)22/h1,3,5,7H,2,4H2,(H2,18,22)(H,19,20,21).
What are the key properties of 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide?
3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide has a molecular weight of 336.18 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyanoethyl)-2-[(2,5-dichloropyrimidin-4-yl)amino]benzamide is sourced from PubChem (CID 151306423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).