C16H30OSi2 — CID 15130694
(1Z,6E)-1,6-bis(trimethylsilylmethylidene)-3,4,5,6a-tetrahydro-2H-pentalen-3a-ol (PubChem CID 15130694) has the molecular formula C16H30OSi2 and a molecular weight of 294.59 g/mol. Its IUPAC name is (1Z,6E)-1,6-bis(trimethylsilylmethylidene)-3,4,5,6a-tetrahydro-2H-pentalen-3a-ol.
| Compound Name | (1Z,6E)-1,6-bis(trimethylsilylmethylidene)-3,4,5,6a-tetrahydro-2H-pentalen-3a-ol |
|---|---|
| PubChem CID | 15130694 |
| Molecular Formula | C16H30OSi2 |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (1Z,6E)-1,6-bis(trimethylsilylmethylidene)-3,4,5,6a-tetrahydro-2H-pentalen-3a-ol |
| SMILES | C[Si](C)(C)/C=C1/CCC2(O)CC/C(=C\[Si](C)(C)C)C12 |
| InChI | InChI=1S/C16H30OSi2/c1-18(2,3)11-13-7-9-16(17)10-8-14(15(13)16)12-19(4,5)6/h11-12,15,17H,7-10H2,1-6H3/b13-11-,14-12+ |
| InChIKey | DZBGSRDVBBQPAX-HEEUSZRZSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|