C13H17NO2 — CID 15131076
(4aR,10aR)-6-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine (PubChem CID 15131076) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (4aR,10aR)-6-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine.
| Compound Name | (4aR,10aR)-6-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine |
|---|---|
| PubChem CID | 15131076 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (4aR,10aR)-6-methoxy-3,4,4a,5,10,10a-hexahydro-2H-benzo[g][1,4]benzoxazine |
| SMILES | COc1cccc2c1C[C@H]1NCCO[C@@H]1C2 |
| InChI | InChI=1S/C13H17NO2/c1-15-12-4-2-3-9-7-13-11(8-10(9)12)14-5-6-16-13/h2-4,11,13-14H,5-8H2,1H3/t11-,13-/m1/s1 |
| InChIKey | CEILQBOYXMJPAS-DGCLKSJQSA-N |
| XLogP | 1.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |