About bis(2-aminobenzene-4-id-1-ol);lanthanum
bis(2-aminobenzene-4-id-1-ol);lanthanum (PubChem CID 151310763) has the molecular formula C12H12LaN2O2-2
and a molecular weight of 355.15 g/mol. Its IUPAC name is bis(2-aminobenzene-4-id-1-ol);lanthanum.
Molecular Properties
| Compound Name | bis(2-aminobenzene-4-id-1-ol);lanthanum |
| PubChem CID | 151310763 |
| Molecular Formula | C12H12LaN2O2-2 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | bis(2-aminobenzene-4-id-1-ol);lanthanum |
| SMILES | Nc1c[c-]ccc1O.Nc1c[c-]ccc1O.[La] |
| InChI | InChI=1S/2C6H6NO.La/c2*7-5-3-1-2-4-6(5)8;/h2*2-4,8H,7H2;/q2*-1; |
| InChIKey | CBLFQYBIPOPONH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminobenzene-4-id-1-ol);lanthanum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminobenzene-4-id-1-ol);lanthanum?
The IUPAC name of bis(2-aminobenzene-4-id-1-ol);lanthanum (CID 151310763) is bis(2-aminobenzene-4-id-1-ol);lanthanum.
What is the SMILES notation for bis(2-aminobenzene-4-id-1-ol);lanthanum?
The canonical SMILES for bis(2-aminobenzene-4-id-1-ol);lanthanum is Nc1c[c-]ccc1O.Nc1c[c-]ccc1O.[La].
What is the InChIKey of bis(2-aminobenzene-4-id-1-ol);lanthanum?
The InChIKey is CBLFQYBIPOPONH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6NO.La/c2*7-5-3-1-2-4-6(5)8;/h2*2-4,8H,7H2;/q2*-1;.
What are the key properties of bis(2-aminobenzene-4-id-1-ol);lanthanum?
bis(2-aminobenzene-4-id-1-ol);lanthanum has a molecular weight of 355.15 g/mol, XLogP of 1.55, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminobenzene-4-id-1-ol);lanthanum is sourced from PubChem (CID 151310763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).