About N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide
N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide (PubChem CID 15131166) has the molecular formula C7H14N6O2S
and a molecular weight of 246.30 g/mol. Its IUPAC name is N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide |
| PubChem CID | 15131166 |
| Molecular Formula | C7H14N6O2S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide |
| SMILES | Nc1nc(NS(=O)(=O)N2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C7H14N6O2S/c8-6-9-7(11-10-6)12-16(14,15)13-4-2-1-3-5-13/h1-5H2,(H4,8,9,10,11,12) |
| InChIKey | NGVAPGQBDKMDJF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide?
The IUPAC name of N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide (CID 15131166) is N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide.
What is the SMILES notation for N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide?
The canonical SMILES for N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide is Nc1nc(NS(=O)(=O)N2CCCCC2)n[nH]1.
What is the InChIKey of N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide?
The InChIKey is NGVAPGQBDKMDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N6O2S/c8-6-9-7(11-10-6)12-16(14,15)13-4-2-1-3-5-13/h1-5H2,(H4,8,9,10,11,12).
What are the key properties of N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide?
N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide has a molecular weight of 246.30 g/mol, XLogP of -0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1H-1,2,4-triazol-3-yl)piperidine-1-sulfonamide is sourced from PubChem (CID 15131166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).