About 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine
2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine (PubChem CID 15131255) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine.
Molecular Properties
| Compound Name | 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine |
| PubChem CID | 15131255 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine |
| SMILES | C(C#CN1CCCCC1)#Cc1ccccn1 |
| InChI | InChI=1S/C14H14N2/c1-5-11-16(12-6-1)13-7-3-9-14-8-2-4-10-15-14/h2,4,8,10H,1,5-6,11-12H2 |
| InChIKey | XAVNRSFRHFRGAO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine?
The IUPAC name of 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine (CID 15131255) is 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine.
What is the SMILES notation for 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine?
The canonical SMILES for 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine is C(C#CN1CCCCC1)#Cc1ccccn1.
What is the InChIKey of 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine?
The InChIKey is XAVNRSFRHFRGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2/c1-5-11-16(12-6-1)13-7-3-9-14-8-2-4-10-15-14/h2,4,8,10H,1,5-6,11-12H2.
What are the key properties of 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine?
2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine has a molecular weight of 210.28 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-piperidin-1-ylbuta-1,3-diynyl)pyridine is sourced from PubChem (CID 15131255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).