C32H50ClN5O2 — CID 15131557
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]octanamide (PubChem CID 15131557) has the molecular formula C32H50ClN5O2 and a molecular weight of 572.24 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]octanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]octanamide |
|---|---|
| PubChem CID | 15131557 |
| Molecular Formula | C32H50ClN5O2 |
| Molecular Weight | 572.24 g/mol |
| Exact Mass | 571.37 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)propyl]octanamide |
| SMILES | CCCCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)NCC(C)c1nc2c(Cl)c(C)[nH]n2n1 |
| InChI | InChI=1S/C32H50ClN5O2/c1-10-13-14-15-16-26(30(39)34-20-21(4)28-35-29-27(33)22(5)36-38(29)37-28)40-25-18-17-23(31(6,7)11-2)19-24(25)32(8,9)12-3/h17-19,21,26,36H,10-16,20H2,1-9H3,(H,34,39) |
| InChIKey | IJKWRCYFGFBNQY-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.24 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|