About 2-tert-butyl-1,2-benzodiazepine
2-tert-butyl-1,2-benzodiazepine (PubChem CID 151318527) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 2-tert-butyl-1,2-benzodiazepine.
Molecular Properties
| Compound Name | 2-tert-butyl-1,2-benzodiazepine |
| PubChem CID | 151318527 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-tert-butyl-1,2-benzodiazepine |
| SMILES | CC(C)(C)N1C=CC=c2ccccc2=N1 |
| InChI | InChI=1S/C13H16N2/c1-13(2,3)15-10-6-8-11-7-4-5-9-12(11)14-15/h4-10H,1-3H3 |
| InChIKey | OFYNBQOECNUMCI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-1,2-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,2-benzodiazepine?
The IUPAC name of 2-tert-butyl-1,2-benzodiazepine (CID 151318527) is 2-tert-butyl-1,2-benzodiazepine.
What is the SMILES notation for 2-tert-butyl-1,2-benzodiazepine?
The canonical SMILES for 2-tert-butyl-1,2-benzodiazepine is CC(C)(C)N1C=CC=c2ccccc2=N1.
What is the InChIKey of 2-tert-butyl-1,2-benzodiazepine?
The InChIKey is OFYNBQOECNUMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-13(2,3)15-10-6-8-11-7-4-5-9-12(11)14-15/h4-10H,1-3H3.
What are the key properties of 2-tert-butyl-1,2-benzodiazepine?
2-tert-butyl-1,2-benzodiazepine has a molecular weight of 200.29 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,2-benzodiazepine is sourced from PubChem (CID 151318527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).