About 8-methoxy-1,4-benzodiazepin-2-one
8-methoxy-1,4-benzodiazepin-2-one (PubChem CID 151321351) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 8-methoxy-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 8-methoxy-1,4-benzodiazepin-2-one |
| PubChem CID | 151321351 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 8-methoxy-1,4-benzodiazepin-2-one |
| SMILES | COc1ccc2cncc(=O)nc2c1 |
| InChI | InChI=1S/C10H8N2O2/c1-14-8-3-2-7-5-11-6-10(13)12-9(7)4-8/h2-6H,1H3 |
| InChIKey | OGNIMDIVVQVYKQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1,4-benzodiazepin-2-one?
The IUPAC name of 8-methoxy-1,4-benzodiazepin-2-one (CID 151321351) is 8-methoxy-1,4-benzodiazepin-2-one.
What is the SMILES notation for 8-methoxy-1,4-benzodiazepin-2-one?
The canonical SMILES for 8-methoxy-1,4-benzodiazepin-2-one is COc1ccc2cncc(=O)nc2c1.
What is the InChIKey of 8-methoxy-1,4-benzodiazepin-2-one?
The InChIKey is OGNIMDIVVQVYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-14-8-3-2-7-5-11-6-10(13)12-9(7)4-8/h2-6H,1H3.
What are the key properties of 8-methoxy-1,4-benzodiazepin-2-one?
8-methoxy-1,4-benzodiazepin-2-one has a molecular weight of 188.19 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1,4-benzodiazepin-2-one is sourced from PubChem (CID 151321351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).