About 7-bromo-9H-carbazol-1-ol
7-bromo-9H-carbazol-1-ol (PubChem CID 151328932) has the molecular formula C12H8BrNO
and a molecular weight of 262.11 g/mol. Its IUPAC name is 7-bromo-9H-carbazol-1-ol.
Molecular Properties
| Compound Name | 7-bromo-9H-carbazol-1-ol |
| PubChem CID | 151328932 |
| Molecular Formula | C12H8BrNO |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 7-bromo-9H-carbazol-1-ol |
| SMILES | Oc1cccc2c1[nH]c1cc(Br)ccc12 |
| InChI | InChI=1S/C12H8BrNO/c13-7-4-5-8-9-2-1-3-11(15)12(9)14-10(8)6-7/h1-6,14-15H |
| InChIKey | OIAWSIPIPBRAKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-9H-carbazol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-9H-carbazol-1-ol?
The IUPAC name of 7-bromo-9H-carbazol-1-ol (CID 151328932) is 7-bromo-9H-carbazol-1-ol.
What is the SMILES notation for 7-bromo-9H-carbazol-1-ol?
The canonical SMILES for 7-bromo-9H-carbazol-1-ol is Oc1cccc2c1[nH]c1cc(Br)ccc12.
What is the InChIKey of 7-bromo-9H-carbazol-1-ol?
The InChIKey is OIAWSIPIPBRAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO/c13-7-4-5-8-9-2-1-3-11(15)12(9)14-10(8)6-7/h1-6,14-15H.
What are the key properties of 7-bromo-9H-carbazol-1-ol?
7-bromo-9H-carbazol-1-ol has a molecular weight of 262.11 g/mol, XLogP of 3.79, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-9H-carbazol-1-ol is sourced from PubChem (CID 151328932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).