C21H18N4 — CID 151330354
2,4,6-triphenyl-2H-1,3,5-triazin-1-amine (PubChem CID 151330354) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2,4,6-triphenyl-2H-1,3,5-triazin-1-amine.
| Compound Name | 2,4,6-triphenyl-2H-1,3,5-triazin-1-amine |
|---|---|
| PubChem CID | 151330354 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2,4,6-triphenyl-2H-1,3,5-triazin-1-amine |
| SMILES | NN1C(c2ccccc2)=NC(c2ccccc2)=NC1c1ccccc1 |
| InChI | InChI=1S/C21H18N4/c22-25-20(17-12-6-2-7-13-17)23-19(16-10-4-1-5-11-16)24-21(25)18-14-8-3-9-15-18/h1-15,20H,22H2 |
| InChIKey | OIICVRFOELCMRL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|