About 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide
4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide (PubChem CID 15133119) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide |
| PubChem CID | 15133119 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide |
| SMILES | CN(C)C(=O)C1CCC(O)CC1 |
| InChI | InChI=1S/C9H17NO2/c1-10(2)9(12)7-3-5-8(11)6-4-7/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | QQKGSHRFTFVNRA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide?
The IUPAC name of 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide (CID 15133119) is 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide.
What is the SMILES notation for 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide?
The canonical SMILES for 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide is CN(C)C(=O)C1CCC(O)CC1.
What is the InChIKey of 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide?
The InChIKey is QQKGSHRFTFVNRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-10(2)9(12)7-3-5-8(11)6-4-7/h7-8,11H,3-6H2,1-2H3.
What are the key properties of 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide?
4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide has a molecular weight of 171.24 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N,N-dimethylcyclohexane-1-carboxamide is sourced from PubChem (CID 15133119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).