C18H25N3O4 — CID 151331273
2-[amino-[[2-(cyclohexanecarbonyl)phenyl]carbamoyl]amino]ethyl acetate (PubChem CID 151331273) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[amino-[[2-(cyclohexanecarbonyl)phenyl]carbamoyl]amino]ethyl acetate.
| Compound Name | 2-[amino-[[2-(cyclohexanecarbonyl)phenyl]carbamoyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 151331273 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[amino-[[2-(cyclohexanecarbonyl)phenyl]carbamoyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCN(N)C(=O)Nc1ccccc1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H25N3O4/c1-13(22)25-12-11-21(19)18(24)20-16-10-6-5-9-15(16)17(23)14-7-3-2-4-8-14/h5-6,9-10,14H,2-4,7-8,11-12,19H2,1H3,(H,20,24) |
| InChIKey | OIMXUONYWBWEKA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|