About 2,5-dimethylthiophene-3,4-diamine
2,5-dimethylthiophene-3,4-diamine (PubChem CID 15133594) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is 2,5-dimethylthiophene-3,4-diamine.
Molecular Properties
| Compound Name | 2,5-dimethylthiophene-3,4-diamine |
| PubChem CID | 15133594 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2,5-dimethylthiophene-3,4-diamine |
| SMILES | Cc1sc(C)c(N)c1N |
| InChI | InChI=1S/C6H10N2S/c1-3-5(7)6(8)4(2)9-3/h7-8H2,1-2H3 |
| InChIKey | NJPZKGHIAIJHRL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethylthiophene-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylthiophene-3,4-diamine?
The IUPAC name of 2,5-dimethylthiophene-3,4-diamine (CID 15133594) is 2,5-dimethylthiophene-3,4-diamine.
What is the SMILES notation for 2,5-dimethylthiophene-3,4-diamine?
The canonical SMILES for 2,5-dimethylthiophene-3,4-diamine is Cc1sc(C)c(N)c1N.
What is the InChIKey of 2,5-dimethylthiophene-3,4-diamine?
The InChIKey is NJPZKGHIAIJHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-3-5(7)6(8)4(2)9-3/h7-8H2,1-2H3.
What are the key properties of 2,5-dimethylthiophene-3,4-diamine?
2,5-dimethylthiophene-3,4-diamine has a molecular weight of 142.23 g/mol, XLogP of 1.53, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylthiophene-3,4-diamine is sourced from PubChem (CID 15133594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).