C11H13Br2N3O2 — CID 151336578
9,9-dibromo-2,6-dimethyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 151336578) has the molecular formula C11H13Br2N3O2 and a molecular weight of 379.05 g/mol. Its IUPAC name is 9,9-dibromo-2,6-dimethyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 9,9-dibromo-2,6-dimethyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 151336578 |
| Molecular Formula | C11H13Br2N3O2 |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 9,9-dibromo-2,6-dimethyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | Cc1nc2n(c(=O)c1C(N)=O)C(C)CCC2(Br)Br |
| InChI | InChI=1S/C11H13Br2N3O2/c1-5-3-4-11(12,13)10-15-6(2)7(8(14)17)9(18)16(5)10/h5H,3-4H2,1-2H3,(H2,14,17) |
| InChIKey | OJOHXULGHSJOTJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|