About 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole
2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole (PubChem CID 15133694) has the molecular formula C12H11N3O2S2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole.
Molecular Properties
| Compound Name | 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole |
| PubChem CID | 15133694 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole |
| SMILES | COc1ccnc(CS(=O)c2nc3sccc3[nH]2)c1 |
| InChI | InChI=1S/C12H11N3O2S2/c1-17-9-2-4-13-8(6-9)7-19(16)12-14-10-3-5-18-11(10)15-12/h2-6H,7H2,1H3,(H,14,15) |
| InChIKey | NCDFZZDDHNTZIO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole?
The IUPAC name of 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole (CID 15133694) is 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole.
What is the SMILES notation for 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole?
The canonical SMILES for 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole is COc1ccnc(CS(=O)c2nc3sccc3[nH]2)c1.
What is the InChIKey of 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole?
The InChIKey is NCDFZZDDHNTZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2S2/c1-17-9-2-4-13-8(6-9)7-19(16)12-14-10-3-5-18-11(10)15-12/h2-6H,7H2,1H3,(H,14,15).
What are the key properties of 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole?
2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole has a molecular weight of 293.37 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxy-2-pyridinyl)methylsulfinyl]-1H-thieno[2,3-d]imidazole is sourced from PubChem (CID 15133694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).