C26H48O2 — CID 151337137
2,3,5,6-tetraethyl-2,3-bis(hept-6-enyl)-1,4-dioxane (PubChem CID 151337137) has the molecular formula C26H48O2 and a molecular weight of 392.67 g/mol. Its IUPAC name is 2,3,5,6-tetraethyl-2,3-bis(hept-6-enyl)-1,4-dioxane.
| Compound Name | 2,3,5,6-tetraethyl-2,3-bis(hept-6-enyl)-1,4-dioxane |
|---|---|
| PubChem CID | 151337137 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | 2,3,5,6-tetraethyl-2,3-bis(hept-6-enyl)-1,4-dioxane |
| SMILES | C=CCCCCCC1(CC)OC(CC)C(CC)OC1(CC)CCCCCC=C |
| InChI | InChI=1S/C26H48O2/c1-7-13-15-17-19-21-25(11-5)26(12-6,22-20-18-16-14-8-2)28-24(10-4)23(9-3)27-25/h7-8,23-24H,1-2,9-22H2,3-6H3 |
| InChIKey | OJRARPAJLCCLAK-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|