About N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide
N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide (PubChem CID 151337531) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide.
Molecular Properties
| Compound Name | N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide |
| PubChem CID | 151337531 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide |
| SMILES | C/C=C(/C)NC(=O)CC(C)CCCC(C)C |
| InChI | InChI=1S/C14H27NO/c1-6-13(5)15-14(16)10-12(4)9-7-8-11(2)3/h6,11-12H,7-10H2,1-5H3,(H,15,16)/b13-6- |
| InChIKey | OJTFDCWIHFIYMV-MLPAPPSSSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide?
The IUPAC name of N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide (CID 151337531) is N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide.
What is the SMILES notation for N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide?
The canonical SMILES for N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide is C/C=C(/C)NC(=O)CC(C)CCCC(C)C.
What is the InChIKey of N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide?
The InChIKey is OJTFDCWIHFIYMV-MLPAPPSSSA-N. The full InChI is InChI=1S/C14H27NO/c1-6-13(5)15-14(16)10-12(4)9-7-8-11(2)3/h6,11-12H,7-10H2,1-5H3,(H,15,16)/b13-6-.
What are the key properties of N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide?
N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide has a molecular weight of 225.38 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-2-en-2-yl]-3,7-dimethyloctanamide is sourced from PubChem (CID 151337531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).