C19H13ClN2O3S — CID 15133842
2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]-4-oxophthalazin-1-yl]acetic acid (PubChem CID 15133842) has the molecular formula C19H13ClN2O3S and a molecular weight of 384.84 g/mol. Its IUPAC name is 2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]-4-oxophthalazin-1-yl]acetic acid.
| Compound Name | 2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]-4-oxophthalazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 15133842 |
| Molecular Formula | C19H13ClN2O3S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[3-[(5-chloro-1-benzothiophen-2-yl)methyl]-4-oxophthalazin-1-yl]acetic acid |
| SMILES | O=C(O)Cc1nn(Cc2cc3cc(Cl)ccc3s2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H13ClN2O3S/c20-12-5-6-17-11(7-12)8-13(26-17)10-22-19(25)15-4-2-1-3-14(15)16(21-22)9-18(23)24/h1-8H,9-10H2,(H,23,24) |
| InChIKey | KFMHGKGDXSFCFC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |