About 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol
1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol (PubChem CID 151339407) has the molecular formula C9H10ClF3N2S2
and a molecular weight of 302.77 g/mol. Its IUPAC name is 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol.
Molecular Properties
| Compound Name | 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol |
| PubChem CID | 151339407 |
| Molecular Formula | C9H10ClF3N2S2 |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol |
| SMILES | CC(S)(S)CNc1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C9H10ClF3N2S2/c1-8(16,17)4-14-5-2-3-6(9(11,12)13)15-7(5)10/h2-3,14,16-17H,4H2,1H3 |
| InChIKey | OKDKMMKPJXJXMV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol?
The IUPAC name of 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol (CID 151339407) is 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol.
What is the SMILES notation for 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol?
The canonical SMILES for 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol is CC(S)(S)CNc1ccc(C(F)(F)F)nc1Cl.
What is the InChIKey of 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol?
The InChIKey is OKDKMMKPJXJXMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF3N2S2/c1-8(16,17)4-14-5-2-3-6(9(11,12)13)15-7(5)10/h2-3,14,16-17H,4H2,1H3.
What are the key properties of 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol?
1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol has a molecular weight of 302.77 g/mol, XLogP of 3.74, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]amino]propane-2,2-dithiol is sourced from PubChem (CID 151339407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).