C26H35N2+ — CID 151340685
1-(2-methyl-1,2-diphenylheptan-3-yl)-3-propylimidazol-3-ium (PubChem CID 151340685) has the molecular formula C26H35N2+ and a molecular weight of 375.58 g/mol. Its IUPAC name is 1-(2-methyl-1,2-diphenylheptan-3-yl)-3-propylimidazol-3-ium.
| Compound Name | 1-(2-methyl-1,2-diphenylheptan-3-yl)-3-propylimidazol-3-ium |
|---|---|
| PubChem CID | 151340685 |
| Molecular Formula | C26H35N2+ |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | 1-(2-methyl-1,2-diphenylheptan-3-yl)-3-propylimidazol-3-ium |
| SMILES | CCCCC(n1cc[n+](CCC)c1)C(C)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35N2/c1-4-6-17-25(28-20-19-27(22-28)18-5-2)26(3,24-15-11-8-12-16-24)21-23-13-9-7-10-14-23/h7-16,19-20,22,25H,4-6,17-18,21H2,1-3H3/q+1 |
| InChIKey | OKKGNHIBINDWCQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|