C28H16N2O4 — CID 15134072
2,3-diphenyl-1,4-dihydronaphtho[3,2-g]quinoxaline-5,6,11,12-tetrone (PubChem CID 15134072) has the molecular formula C28H16N2O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is 2,3-diphenyl-1,4-dihydronaphtho[3,2-g]quinoxaline-5,6,11,12-tetrone.
| Compound Name | 2,3-diphenyl-1,4-dihydronaphtho[3,2-g]quinoxaline-5,6,11,12-tetrone |
|---|---|
| PubChem CID | 15134072 |
| Molecular Formula | C28H16N2O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2,3-diphenyl-1,4-dihydronaphtho[3,2-g]quinoxaline-5,6,11,12-tetrone |
| SMILES | O=c1c2ccccc2c(=O)c2c(=O)c3[nH]c(-c4ccccc4)c(-c4ccccc4)[nH]c3c(=O)c12 |
| InChI | InChI=1S/C28H16N2O4/c31-25-17-13-7-8-14-18(17)26(32)20-19(25)27(33)23-24(28(20)34)30-22(16-11-5-2-6-12-16)21(29-23)15-9-3-1-4-10-15/h1-14,29-30H |
| InChIKey | XMYXVBYAATVHLC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|