C17H14BrN5 — CID 151342074
7-(2,3,3a,4-tetrahydroindol-1-yl)-12-bromo-5,6,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 151342074) has the molecular formula C17H14BrN5 and a molecular weight of 368.24 g/mol. Its IUPAC name is 7-(2,3,3a,4-tetrahydroindol-1-yl)-12-bromo-5,6,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 7-(2,3,3a,4-tetrahydroindol-1-yl)-12-bromo-5,6,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 151342074 |
| Molecular Formula | C17H14BrN5 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 7-(2,3,3a,4-tetrahydroindol-1-yl)-12-bromo-5,6,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | Brc1cnc2nc(N3CCC4CC=CC=C43)n3nccc3c2c1 |
| InChI | InChI=1S/C17H14BrN5/c18-12-9-13-15-5-7-20-23(15)17(21-16(13)19-10-12)22-8-6-11-3-1-2-4-14(11)22/h1-2,4-5,7,9-11H,3,6,8H2 |
| InChIKey | OKRSNYJAAXHLMU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |