About 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane
1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane (PubChem CID 151342530) has the molecular formula C13H17Br
and a molecular weight of 253.18 g/mol. Its IUPAC name is 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane.
Molecular Properties
| Compound Name | 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane |
| PubChem CID | 151342530 |
| Molecular Formula | C13H17Br |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane |
| SMILES | CC(=C1C=CC=C1Br)C1CCCCC1 |
| InChI | InChI=1S/C13H17Br/c1-10(11-6-3-2-4-7-11)12-8-5-9-13(12)14/h5,8-9,11H,2-4,6-7H2,1H3 |
| InChIKey | OKTYPNQCQVKOPZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane?
The IUPAC name of 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane (CID 151342530) is 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane.
What is the SMILES notation for 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane?
The canonical SMILES for 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane is CC(=C1C=CC=C1Br)C1CCCCC1.
What is the InChIKey of 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane?
The InChIKey is OKTYPNQCQVKOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Br/c1-10(11-6-3-2-4-7-11)12-8-5-9-13(12)14/h5,8-9,11H,2-4,6-7H2,1H3.
What are the key properties of 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane?
1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane has a molecular weight of 253.18 g/mol, XLogP of 4.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromocyclopenta-2,4-dien-1-ylidene)ethylcyclohexane is sourced from PubChem (CID 151342530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).