C35H35F3N4O4S — CID 151343508
10-[1-(1H-inden-1-yl)-6-methoxy-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]decanoic acid (PubChem CID 151343508) has the molecular formula C35H35F3N4O4S and a molecular weight of 664.75 g/mol. Its IUPAC name is 10-[1-(1H-inden-1-yl)-6-methoxy-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]decanoic acid.
| Compound Name | 10-[1-(1H-inden-1-yl)-6-methoxy-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]decanoic acid |
|---|---|
| PubChem CID | 151343508 |
| Molecular Formula | C35H35F3N4O4S |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | 10-[1-(1H-inden-1-yl)-6-methoxy-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]decanoic acid |
| SMILES | COc1cc2c(cc1CCCCCCCCCC(=O)O)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C1C=Cc2ccccc21 |
| InChI | InChI=1S/C35H35F3N4O4S/c1-45-30-21-29-27(19-23(30)12-7-5-3-2-4-6-8-14-32(43)44)39-33(42(29)28-18-15-22-11-9-10-13-25(22)28)41-34-40-26-17-16-24(20-31(26)47-34)46-35(36,37)38/h9-11,13,15-21,28H,2-8,12,14H2,1H3,(H,43,44)(H,39,40,41) |
| InChIKey | OKYYJURXZBAVTB-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|