About 2,3-dimethyl-1H-arsonine
2,3-dimethyl-1H-arsonine (PubChem CID 151346463) has the molecular formula C10H13As
and a molecular weight of 208.14 g/mol. Its IUPAC name is 2,3-dimethyl-1H-arsonine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-arsonine |
| PubChem CID | 151346463 |
| Molecular Formula | C10H13As |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 2,3-dimethyl-1H-arsonine |
| SMILES | CC1=C(\C)[AsH]/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C10H13As/c1-9-7-5-3-4-6-8-11-10(9)2/h3-8,11H,1-2H3/b4-3-,7-5-,8-6-,10-9- |
| InChIKey | OLONUCYRGMZRCW-JZYNTAPWSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-arsonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-arsonine?
The IUPAC name of 2,3-dimethyl-1H-arsonine (CID 151346463) is 2,3-dimethyl-1H-arsonine.
What is the SMILES notation for 2,3-dimethyl-1H-arsonine?
The canonical SMILES for 2,3-dimethyl-1H-arsonine is CC1=C(\C)[AsH]/C=C\C=C/C=C\1.
What is the InChIKey of 2,3-dimethyl-1H-arsonine?
The InChIKey is OLONUCYRGMZRCW-JZYNTAPWSA-N. The full InChI is InChI=1S/C10H13As/c1-9-7-5-3-4-6-8-11-10(9)2/h3-8,11H,1-2H3/b4-3-,7-5-,8-6-,10-9-.
What are the key properties of 2,3-dimethyl-1H-arsonine?
2,3-dimethyl-1H-arsonine has a molecular weight of 208.14 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-arsonine is sourced from PubChem (CID 151346463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).