About tripyrrolidin-1-ylsilane
tripyrrolidin-1-ylsilane (PubChem CID 15134731) has the molecular formula C12H25N3Si
and a molecular weight of 239.44 g/mol. Its IUPAC name is tripyrrolidin-1-ylsilane.
Molecular Properties
| Compound Name | tripyrrolidin-1-ylsilane |
| PubChem CID | 15134731 |
| Molecular Formula | C12H25N3Si |
| Molecular Weight | 239.44 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | tripyrrolidin-1-ylsilane |
| SMILES | C1CCN([SiH](N2CCCC2)N2CCCC2)C1 |
| InChI | InChI=1S/C12H25N3Si/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15/h16H,1-12H2 |
| InChIKey | SROINZBXHCGZSP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tripyrrolidin-1-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripyrrolidin-1-ylsilane?
The IUPAC name of tripyrrolidin-1-ylsilane (CID 15134731) is tripyrrolidin-1-ylsilane.
What is the SMILES notation for tripyrrolidin-1-ylsilane?
The canonical SMILES for tripyrrolidin-1-ylsilane is C1CCN([SiH](N2CCCC2)N2CCCC2)C1.
What is the InChIKey of tripyrrolidin-1-ylsilane?
The InChIKey is SROINZBXHCGZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3Si/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15/h16H,1-12H2.
What are the key properties of tripyrrolidin-1-ylsilane?
tripyrrolidin-1-ylsilane has a molecular weight of 239.44 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tripyrrolidin-1-ylsilane is sourced from PubChem (CID 15134731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).