About 1-propan-2-ylsiletane
1-propan-2-ylsiletane (PubChem CID 15134745) has the molecular formula C6H14Si
and a molecular weight of 114.26 g/mol. Its IUPAC name is 1-propan-2-ylsiletane.
Molecular Properties
| Compound Name | 1-propan-2-ylsiletane |
| PubChem CID | 15134745 |
| Molecular Formula | C6H14Si |
| Molecular Weight | 114.26 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | 1-propan-2-ylsiletane |
| SMILES | CC(C)[SiH]1CCC1 |
| InChI | InChI=1S/C6H14Si/c1-6(2)7-4-3-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | XHSPQPPZSCMQMJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-ylsiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylsiletane?
The IUPAC name of 1-propan-2-ylsiletane (CID 15134745) is 1-propan-2-ylsiletane.
What is the SMILES notation for 1-propan-2-ylsiletane?
The canonical SMILES for 1-propan-2-ylsiletane is CC(C)[SiH]1CCC1.
What is the InChIKey of 1-propan-2-ylsiletane?
The InChIKey is XHSPQPPZSCMQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14Si/c1-6(2)7-4-3-5-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 1-propan-2-ylsiletane?
1-propan-2-ylsiletane has a molecular weight of 114.26 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylsiletane is sourced from PubChem (CID 15134745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).