About 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane
2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane (PubChem CID 151349350) has the molecular formula C11H13ClO
and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane.
Molecular Properties
| Compound Name | 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane |
| PubChem CID | 151349350 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane |
| SMILES | Cc1c(Cl)cccc1C1(C)OC1C |
| InChI | InChI=1S/C11H13ClO/c1-7-9(5-4-6-10(7)12)11(3)8(2)13-11/h4-6,8H,1-3H3 |
| InChIKey | OMDNQUVIPDNZSR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane?
The IUPAC name of 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane (CID 151349350) is 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane.
What is the SMILES notation for 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane?
The canonical SMILES for 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane is Cc1c(Cl)cccc1C1(C)OC1C.
What is the InChIKey of 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane?
The InChIKey is OMDNQUVIPDNZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO/c1-7-9(5-4-6-10(7)12)11(3)8(2)13-11/h4-6,8H,1-3H3.
What are the key properties of 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane?
2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane has a molecular weight of 196.68 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2-methylphenyl)-2,3-dimethyloxirane is sourced from PubChem (CID 151349350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).