About ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate
ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate (PubChem CID 15134949) has the molecular formula C8H8F6N2O2
and a molecular weight of 278.15 g/mol. Its IUPAC name is ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate |
| PubChem CID | 15134949 |
| Molecular Formula | C8H8F6N2O2 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NNC(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H8F6N2O2/c1-2-18-5(17)4-3-6(16-15-4,7(9,10)11)8(12,13)14/h16H,2-3H2,1H3 |
| InChIKey | ZDPSBPAENOQLSH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate?
The IUPAC name of ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate (CID 15134949) is ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate?
The canonical SMILES for ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate is CCOC(=O)C1=NNC(C(F)(F)F)(C(F)(F)F)C1.
What is the InChIKey of ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate?
The InChIKey is ZDPSBPAENOQLSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F6N2O2/c1-2-18-5(17)4-3-6(16-15-4,7(9,10)11)8(12,13)14/h16H,2-3H2,1H3.
What are the key properties of ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate?
ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate has a molecular weight of 278.15 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5,5-bis(trifluoromethyl)-1,4-dihydropyrazole-3-carboxylate is sourced from PubChem (CID 15134949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).