About 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid
2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid (PubChem CID 151351396) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid |
| PubChem CID | 151351396 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)N2CCC1C2 |
| InChI | InChI=1S/C7H10N2O3/c10-6(11)4-9-5-1-2-8(3-5)7(9)12/h5H,1-4H2,(H,10,11) |
| InChIKey | OMOGGPWJRKUXIA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid?
The IUPAC name of 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid (CID 151351396) is 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid.
What is the SMILES notation for 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid?
The canonical SMILES for 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid is O=C(O)CN1C(=O)N2CCC1C2.
What is the InChIKey of 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid?
The InChIKey is OMOGGPWJRKUXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c10-6(11)4-9-5-1-2-8(3-5)7(9)12/h5H,1-4H2,(H,10,11).
What are the key properties of 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid?
2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid has a molecular weight of 170.17 g/mol, XLogP of -0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,3-diazabicyclo[2.2.1]heptan-3-yl)acetic acid is sourced from PubChem (CID 151351396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).