About 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline
4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline (PubChem CID 15135150) has the molecular formula C28H28N2O2
and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline.
Molecular Properties
| Compound Name | 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline |
| PubChem CID | 15135150 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline |
| SMILES | Cc1cc(-c2cc(C)c(Oc3ccc(N)cc3)c(C)c2)cc(C)c1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C28H28N2O2/c1-17-13-21(14-18(2)27(17)31-25-9-5-23(29)6-10-25)22-15-19(3)28(20(4)16-22)32-26-11-7-24(30)8-12-26/h5-16H,29-30H2,1-4H3 |
| InChIKey | KLVUEQJLCSGVBX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline?
The IUPAC name of 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline (CID 15135150) is 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline.
What is the SMILES notation for 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline?
The canonical SMILES for 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline is Cc1cc(-c2cc(C)c(Oc3ccc(N)cc3)c(C)c2)cc(C)c1Oc1ccc(N)cc1.
What is the InChIKey of 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline?
The InChIKey is KLVUEQJLCSGVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N2O2/c1-17-13-21(14-18(2)27(17)31-25-9-5-23(29)6-10-25)22-15-19(3)28(20(4)16-22)32-26-11-7-24(30)8-12-26/h5-16H,29-30H2,1-4H3.
What are the key properties of 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline?
4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline has a molecular weight of 424.54 g/mol, XLogP of 7.34, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]aniline is sourced from PubChem (CID 15135150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).