C16H11F16NO6S2 — CID 15135272
bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-aminobenzene-1,3-disulfonate (PubChem CID 15135272) has the molecular formula C16H11F16NO6S2 and a molecular weight of 681.37 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-aminobenzene-1,3-disulfonate.
| Compound Name | bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-aminobenzene-1,3-disulfonate |
|---|---|
| PubChem CID | 15135272 |
| Molecular Formula | C16H11F16NO6S2 |
| Molecular Weight | 681.37 g/mol |
| Exact Mass | 680.98 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-aminobenzene-1,3-disulfonate |
| SMILES | Nc1ccc(S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc1S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H11F16NO6S2/c17-9(18)13(25,26)15(29,30)11(21,22)4-38-40(34,35)6-1-2-7(33)8(3-6)41(36,37)39-5-12(23,24)16(31,32)14(27,28)10(19)20/h1-3,9-10H,4-5,33H2 |
| InChIKey | JXEMCFBNWNROPF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|