About 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol
5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol (PubChem CID 151353831) has the molecular formula C22H17N3OS2
and a molecular weight of 403.53 g/mol. Its IUPAC name is 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol.
Molecular Properties
| Compound Name | 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol |
| PubChem CID | 151353831 |
| Molecular Formula | C22H17N3OS2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol |
| SMILES | SN1OC(c2ccc(-c3cc4ccccc4[nH]3)cc2)=CC1(S)c1cccnc1 |
| InChI | InChI=1S/C22H17N3OS2/c27-22(18-5-3-11-23-14-18)13-21(26-25(22)28)16-9-7-15(8-10-16)20-12-17-4-1-2-6-19(17)24-20/h1-14,24,27-28H |
| InChIKey | ONAYWCIJBUZUDY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol?
The IUPAC name of 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol (CID 151353831) is 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol.
What is the SMILES notation for 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol?
The canonical SMILES for 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol is SN1OC(c2ccc(-c3cc4ccccc4[nH]3)cc2)=CC1(S)c1cccnc1.
What is the InChIKey of 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol?
The InChIKey is ONAYWCIJBUZUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3OS2/c27-22(18-5-3-11-23-14-18)13-21(26-25(22)28)16-9-7-15(8-10-16)20-12-17-4-1-2-6-19(17)24-20/h1-14,24,27-28H.
What are the key properties of 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol?
5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol has a molecular weight of 403.53 g/mol, XLogP of 5.45, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1H-indol-2-yl)phenyl]-3-pyridin-3-yl-2-sulfanyl-1,2-oxazole-3-thiol is sourced from PubChem (CID 151353831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).