1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid

C12H15NO3 — CID 151354845

IUPAC1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1(C(=O)N2CCCC2)C=CC=CC1
InChIInChI=1S/C12H15NO3/c14-10(13-8-4-5-9-13)12(11(15)16)6-2-1-3-7-12/h1-3,6H,4-5,7-9H2,(H,15,16)
InChIKeyONGLEOULAXMRCA-UHFFFAOYSA-N
MW221.26 g/mol
LogP1.20
Rot. Bonds2

About 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid

1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 151354845) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid
PubChem CID151354845
Molecular FormulaC12H15NO3
Molecular Weight221.26 g/mol
Exact Mass221.11
IUPAC Name1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1(C(=O)N2CCCC2)C=CC=CC1
InChIInChI=1S/C12H15NO3/c14-10(13-8-4-5-9-13)12(11(15)16)6-2-1-3-7-12/h1-3,6H,4-5,7-9H2,(H,15,16)
InChIKeyONGLEOULAXMRCA-UHFFFAOYSA-N
XLogP1.20
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.26
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid (CID 151354845) is 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1(C(=O)N2CCCC2)C=CC=CC1.
What is the InChIKey of 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is ONGLEOULAXMRCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c14-10(13-8-4-5-9-13)12(11(15)16)6-2-1-3-7-12/h1-3,6H,4-5,7-9H2,(H,15,16).
What are the key properties of 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid?
1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 221.26 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pyrrolidine-1-carbonyl)cyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 151354845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).