About 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate
2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate (PubChem CID 151359954) has the molecular formula C12H10BrF3N2O2
and a molecular weight of 351.12 g/mol. Its IUPAC name is 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate |
| PubChem CID | 151359954 |
| Molecular Formula | C12H10BrF3N2O2 |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1cn2cc(Br)cc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C12H10BrF3N2O2/c1-7(19)20-3-2-9-6-18-5-8(13)4-10(11(18)17-9)12(14,15)16/h4-6H,2-3H2,1H3 |
| InChIKey | OOGOLLIKCFVHIP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate?
The IUPAC name of 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate (CID 151359954) is 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate.
What is the SMILES notation for 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate?
The canonical SMILES for 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate is CC(=O)OCCc1cn2cc(Br)cc(C(F)(F)F)c2n1.
What is the InChIKey of 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate?
The InChIKey is OOGOLLIKCFVHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrF3N2O2/c1-7(19)20-3-2-9-6-18-5-8(13)4-10(11(18)17-9)12(14,15)16/h4-6H,2-3H2,1H3.
What are the key properties of 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate?
2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate has a molecular weight of 351.12 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-bromo-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]ethyl acetate is sourced from PubChem (CID 151359954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).