About 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile
9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile (PubChem CID 15136156) has the molecular formula C9H5N3O2
and a molecular weight of 187.16 g/mol. Its IUPAC name is 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile.
Molecular Properties
| Compound Name | 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile |
| PubChem CID | 15136156 |
| Molecular Formula | C9H5N3O2 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile |
| SMILES | N#Cc1cnc2c(O)cccn2c1=O |
| InChI | InChI=1S/C9H5N3O2/c10-4-6-5-11-8-7(13)2-1-3-12(8)9(6)14/h1-3,5,13H |
| InChIKey | AOIUOWSBUSUWBB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile?
The IUPAC name of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile (CID 15136156) is 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile.
What is the SMILES notation for 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile?
The canonical SMILES for 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile is N#Cc1cnc2c(O)cccn2c1=O.
What is the InChIKey of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile?
The InChIKey is AOIUOWSBUSUWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O2/c10-4-6-5-11-8-7(13)2-1-3-12(8)9(6)14/h1-3,5,13H.
What are the key properties of 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile?
9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile has a molecular weight of 187.16 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-4-oxopyrido[1,2-a]pyrimidine-3-carbonitrile is sourced from PubChem (CID 15136156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).