C19H24F3N6O2+ — CID 151361842
3-cyclopentyl-N-(methylcarbamoyl)-2-[4-(5-methyl-2H-tetrazol-1-ium-1-yl)-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 151361842) has the molecular formula C19H24F3N6O2+ and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-cyclopentyl-N-(methylcarbamoyl)-2-[4-(5-methyl-2H-tetrazol-1-ium-1-yl)-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-(methylcarbamoyl)-2-[4-(5-methyl-2H-tetrazol-1-ium-1-yl)-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 151361842 |
| Molecular Formula | C19H24F3N6O2+ |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-cyclopentyl-N-(methylcarbamoyl)-2-[4-(5-methyl-2H-tetrazol-1-ium-1-yl)-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CNC(=O)NC(=O)C(CC1CCCC1)c1ccc(-[n+]2[nH]nnc2C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F3N6O2/c1-11-25-26-27-28(11)16-8-7-13(10-15(16)19(20,21)22)14(9-12-5-3-4-6-12)17(29)24-18(30)23-2/h7-8,10,12,14H,3-6,9H2,1-2H3,(H2,23,24,29,30)/p+1 |
| InChIKey | OOQBPGSJGVKPHP-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|