About dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate
dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 15136311) has the molecular formula C22H21NO7
and a molecular weight of 411.41 g/mol. Its IUPAC name is dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 15136311 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CC(=O)OC1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H21NO7/c1-15(24)30-19-12-18(21(26)28-13-16-8-4-2-5-9-16)23(20(19)25)22(27)29-14-17-10-6-3-7-11-17/h2-11,18-19H,12-14H2,1H3/t18-,19?/m0/s1 |
| InChIKey | WLNZLXCDUGNPCU-OYKVQYDMSA-N |
| XLogP | 2.60 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate (CID 15136311) is dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate is CC(=O)OC1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1=O.
What is the InChIKey of dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is WLNZLXCDUGNPCU-OYKVQYDMSA-N. The full InChI is InChI=1S/C22H21NO7/c1-15(24)30-19-12-18(21(26)28-13-16-8-4-2-5-9-16)23(20(19)25)22(27)29-14-17-10-6-3-7-11-17/h2-11,18-19H,12-14H2,1H3/t18-,19?/m0/s1.
What are the key properties of dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate?
dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 411.41 g/mol, XLogP of 2.60, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl (2S)-4-acetyloxy-5-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 15136311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).