About 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene
6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene (PubChem CID 151363384) has the molecular formula C27H52O3
and a molecular weight of 424.71 g/mol. Its IUPAC name is 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene.
Molecular Properties
| Compound Name | 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene |
| PubChem CID | 151363384 |
| Molecular Formula | C27H52O3 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.39 |
| IUPAC Name | 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene |
| SMILES | CC=CC=CC(CCC)(CCCCCCCC)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C27H52O3/c1-10-13-15-16-17-19-22-26(20-12-3,21-18-14-11-2)27(28-23(4)5,29-24(6)7)30-25(8)9/h11,14,18,21,23-25H,10,12-13,15-17,19-20,22H2,1-9H3 |
| InChIKey | OOXPUAZVEGRVEM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene?
The IUPAC name of 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene (CID 151363384) is 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene.
What is the SMILES notation for 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene?
The canonical SMILES for 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene is CC=CC=CC(CCC)(CCCCCCCC)C(OC(C)C)(OC(C)C)OC(C)C.
What is the InChIKey of 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene?
The InChIKey is OOXPUAZVEGRVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H52O3/c1-10-13-15-16-17-19-22-26(20-12-3,21-18-14-11-2)27(28-23(4)5,29-24(6)7)30-25(8)9/h11,14,18,21,23-25H,10,12-13,15-17,19-20,22H2,1-9H3.
What are the key properties of 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene?
6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene has a molecular weight of 424.71 g/mol, XLogP of 8.58, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propyl-6-[tri(propan-2-yloxy)methyl]tetradeca-2,4-diene is sourced from PubChem (CID 151363384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).