About (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine
(2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine (PubChem CID 15136728) has the molecular formula C20H33NO2
and a molecular weight of 319.49 g/mol. Its IUPAC name is (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine |
| PubChem CID | 15136728 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine |
| SMILES | COC(C)(C)c1ccc(CC(C)CN2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C20H33NO2/c1-15(12-21-13-16(2)23-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)22-6/h7-10,15-17H,11-14H2,1-6H3/t15?,16-,17+ |
| InChIKey | XIKQAVVHBFSDDE-ALOPSCKCSA-N |
| XLogP | 3.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine?
The IUPAC name of (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine (CID 15136728) is (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine.
What is the SMILES notation for (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine?
The canonical SMILES for (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine is COC(C)(C)c1ccc(CC(C)CN2C[C@@H](C)O[C@@H](C)C2)cc1.
What is the InChIKey of (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine?
The InChIKey is XIKQAVVHBFSDDE-ALOPSCKCSA-N. The full InChI is InChI=1S/C20H33NO2/c1-15(12-21-13-16(2)23-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)22-6/h7-10,15-17H,11-14H2,1-6H3/t15?,16-,17+.
What are the key properties of (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine?
(2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine has a molecular weight of 319.49 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-4-[3-[4-(2-methoxypropan-2-yl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 15136728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).