C24H25F2NO5 — CID 151367494
(7R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-7-(methoxymethyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 151367494) has the molecular formula C24H25F2NO5 and a molecular weight of 445.46 g/mol. Its IUPAC name is (7R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-7-(methoxymethyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | (7R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-7-(methoxymethyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 151367494 |
| Molecular Formula | C24H25F2NO5 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (7R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-7-(methoxymethyl)-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | COC[C@@H]1CCC2C(=O)C3=C(C=C(C(=O)NCc4ccc(F)cc4F)C(=O)C3O)C[C@H]2C1 |
| InChI | InChI=1S/C24H25F2NO5/c1-32-11-12-2-5-17-14(6-12)7-15-8-18(22(29)23(30)20(15)21(17)28)24(31)27-10-13-3-4-16(25)9-19(13)26/h3-4,8-9,12,14,17,23,30H,2,5-7,10-11H2,1H3,(H,27,31)/t12-,14-,17?,23?/m1/s1 |
| InChIKey | OPSRTSJAZFYVRI-QFVNWNBESA-N |
| XLogP | 2.40 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|