About 2-trityltetrazol-5-amine
2-trityltetrazol-5-amine (PubChem CID 151368620) has the molecular formula C20H17N5
and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-trityltetrazol-5-amine.
Molecular Properties
| Compound Name | 2-trityltetrazol-5-amine |
| PubChem CID | 151368620 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-trityltetrazol-5-amine |
| SMILES | Nc1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C20H17N5/c21-19-22-24-25(23-19)20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H2,21,23) |
| InChIKey | OPYMVJMRCKPIEH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-trityltetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trityltetrazol-5-amine?
The IUPAC name of 2-trityltetrazol-5-amine (CID 151368620) is 2-trityltetrazol-5-amine.
What is the SMILES notation for 2-trityltetrazol-5-amine?
The canonical SMILES for 2-trityltetrazol-5-amine is Nc1nnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of 2-trityltetrazol-5-amine?
The InChIKey is OPYMVJMRCKPIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5/c21-19-22-24-25(23-19)20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H2,21,23).
What are the key properties of 2-trityltetrazol-5-amine?
2-trityltetrazol-5-amine has a molecular weight of 327.39 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trityltetrazol-5-amine is sourced from PubChem (CID 151368620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).