C28H14F4O5S2 — CID 151369947
(2,3-difluoroanthracen-1-yl)sulfonyl 2,3-difluoroanthracene-1-sulfonate (PubChem CID 151369947) has the molecular formula C28H14F4O5S2 and a molecular weight of 570.54 g/mol. Its IUPAC name is (2,3-difluoroanthracen-1-yl)sulfonyl 2,3-difluoroanthracene-1-sulfonate.
| Compound Name | (2,3-difluoroanthracen-1-yl)sulfonyl 2,3-difluoroanthracene-1-sulfonate |
|---|---|
| PubChem CID | 151369947 |
| Molecular Formula | C28H14F4O5S2 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | (2,3-difluoroanthracen-1-yl)sulfonyl 2,3-difluoroanthracene-1-sulfonate |
| SMILES | O=S(=O)(OS(=O)(=O)c1c(F)c(F)cc2cc3ccccc3cc12)c1c(F)c(F)cc2cc3ccccc3cc12 |
| InChI | InChI=1S/C28H14F4O5S2/c29-23-13-19-9-15-5-1-3-7-17(15)11-21(19)27(25(23)31)38(33,34)37-39(35,36)28-22-12-18-8-4-2-6-16(18)10-20(22)14-24(30)26(28)32/h1-14H |
| InChIKey | OQFNBFFXLXMAED-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|