C32H59NO8P+ — CID 151370379
2-[[(2R)-3-hexanoyloxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 151370379) has the molecular formula C32H59NO8P+ and a molecular weight of 616.80 g/mol. Its IUPAC name is 2-[[(2R)-3-hexanoyloxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-hexanoyloxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 151370379 |
| Molecular Formula | C32H59NO8P+ |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | 2-[[(2R)-3-hexanoyloxy-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C32H58NO8P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-23-25-32(35)41-30(28-38-31(34)24-22-9-7-2)29-40-42(36,37)39-27-26-33(3,4)5/h8,10,12-13,15-16,30H,6-7,9,11,14,17-29H2,1-5H3/p+1/b10-8-,13-12-,16-15-/t30-/m1/s1 |
| InChIKey | OQHSEBBMQLMOGU-XTIDHUEUSA-O |
| XLogP | 7.45 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|